Transporter Proteins in Schizosaccharomyces pombe |
ATP-Dependent |
| The ATP-binding Cassette (ABC) Superfamily | |||||
| SPAC9E9.12C(abc1) | bile acid | ||||
| SPCC74.01c(SPCC737.09c) | heavy metal ion efflux | ||||
| SPCC663.03(pmd1) | leptomycin efflux | ||||
| SPAC3F10.11C | multidrug or metal ion efflux | ||||
| SPAC15A10.01(SPAC8C9.18) | ABCB |
mitochonrial heme export? (ATM1 homolog) | |||
| SPBC2G5.09c(mam1) | ABCB |
mating factor (a factor) secretion (STE6 homolog) | |||
| SPAC323.04 | ATP binding component only- metal ion | ||||
| SPAC30.04C | transporter | ||||
| SPBC359.05 | transporter | ||||
| The H+- or Na+-translocating F-type, V-type and A-type ATPase (F-ATPase) Superfamily | |||||
| SPBC1289.05c SPAPB2B4.05 SPAC7D4.10(vma13) SPAC732.01 SPAC11E3.07 SPAC17A2.03C SPAC23C4.11 SPBC1604.07 SPBC1604.11 SPBC1734.13 SPBC31F10.15C SPBC3B9.18C SPCC1840.06 SPCC965.03 SPAC343.05(vma1) SPAC637.05C(vma2) SPCC757.10(vph2) SPAC2C4.13 SPAC16E8.07C SPAC1B3.14(vma3) SPAC222.12c(atp2) SPAC14C4.14(atp1) |
protons | ||||
| The P-type ATPase (P-ATPase) Superfamily | |||||
| SPBC839.06(cta3) |
calcium ion | ||||
| SPAC24B11.12C |
calcium ion | ||||
| SPAC1071.10c(pma1) |
proton ion | ||||
| SPCC1020.01c(SPCC1393.01) |
proton ion | ||||
| SPAC6C3.06C |
calcium ion | ||||
| SPAC29A4.19C |
calcium ion | ||||
| SPAC4F10.16C |
calcium ion | ||||
| SPCC1672.11C |
cation | ||||
| SPBC29A3.01 |
copper ion | ||||
| SPBC887.12 |
calcium ion | ||||
| SPBC31E1.02c(pgak2) |
calcium ion | ||||
| SPACUNK4.07C(SPAPYUK71.01) |
calcium ion | ||||
| SPAC821.13C |
phospholipid ion | ||||
Ion Channels |
| The Ammonia Transporter Channel (Amt) Family | |||||
| SPAC664.14 |
ammonium | ||||
| SPAC2E1P3.02c |
ammonium | ||||
| The Copper Transporter (Ctr) Family | |||||
| SPBC23G7.16 |
copper | ||||
| SPCC1393.10(ctr4) |
copper ion (high affinity) | ||||
| SPAC1142.05 |
copper ion? | ||||
| The Yeast Stretch-Activated, Cation-Selective, Ca2+ Channel, Mid1 (Mid1) Family | |||||
| SPAC1F5.08c(yam8) |
calcium channel | ||||
| The Major Intrinsic Protein (MIP) Family | |||||
| SPAC977.17 |
water channel | ||||
| The CorA Metal Ion Transporter (MIT) Family | |||||
| SPAC17A2.14(SPAC17G6.01) |
family metal ion | ||||
| SPBC27B12.12c |
family metal ion | ||||
| SPBC25H2.08c |
mitochondrial inner membrane magnesium ion channel protein (MRS2) | ||||
| The Small Conductance Mechanosensitive Ion Channel (MscS) Family | |||||
| SPAC2C4.17c |
small-conductance mechanosensitive ion channel | ||||
| SPCC1183.11(SPCC31H12.01) |
small-conductance mechanosensitive ion channel | ||||
| The Voltage-gated Ion Channel (VIC) Superfamily | |||||
| SPAC6F6.01 |
sodium channel | ||||
Secondary Transporter |
| The Amino Acid/Auxin Permease (AAAP) Family | |||||
| SPAC3H1.09C |
amino acid? | ||||
| SPBC1685.07C |
amino acid? | ||||
| The Anion Exchanger (AE) Family | |||||
| SPBC543.05c |
anion exchanger | ||||
| The Auxin Efflux Carrier (AEC) Family | |||||
| SPAC5D6.04 |
auxin efflux? | ||||
| The Amino Acid-Polyamine-Organocation (APC) Family | |||||
| SPAC1039.09(isp5) |
amino acid | ||||
| SPAC11D3.08C |
amino acid | ||||
| SPCC74.04 |
amino acid | ||||
| SPCC777.04 |
amino acid | ||||
| SPBC1652.02(SPBC16A3.20c) |
amino acid | ||||
| SPCC965.11C |
amino acid | ||||
| SPCC794.03 |
amino acid | ||||
| SPCC584.13 |
amino acid | ||||
| SPBC19F8.06C |
amino acid | ||||
| SPBC15C4.04C |
amino acid | ||||
| SPAC869.11(SPAC922.08c) |
amino acid | ||||
| SPAC9.10 |
amino acid | ||||
| SPAC869.10C |
amino acid | ||||
| SPAC1039.01 |
amino acid | ||||
| SPAP7G5.06 |
amino acid | ||||
| SPBC359.03c |
amino acid | ||||
| SPBPB2B2.01 |
amino acid | ||||
| The Aromatic Acid Exporter (ArAE) Family | |||||
| SPAC26F1.08c |
? | ||||
| The Ca2+:Cation Antiporter (CaCA) Family | |||||
| SPAC3A12.06C |
sodium/calcium exchanger | ||||
| SPCC1795.02C(SPCC895.01) |
proton/calcium exchanger | ||||
| SPAC521.04c |
proton/calcium exchanger | ||||
| The Cation-Chloride Cotransporter (CCC) Family | |||||
| SPBC18H10.16 |
Na-K-Cl | ||||
| The Cation Diffusion Facilitator (CDF) Family | |||||
| SPCC1020.03 |
metal cation | ||||
| SPAC23C11.14 |
metal cation (zinc/cadmium?) | ||||
| SPAC17D4.03c |
metal cation efflux | ||||
| The Chloride Carrier/Channel (ClC) Family | |||||
| SPBC887.02 |
chloride channel | ||||
| SPBC19C7.11 |
chloride channel | ||||
| The Monovalent Cation:Proton Antiporter-1 (CPA1) Family | |||||
| SPAC977.10(sod2) |
sodium ion/proton antiporter | ||||
| SPAC15A10.06 |
sodium ion/proton antiporter | ||||
| SPAC3A11.09 |
sodium ion/proton antiporter | ||||
| The Monovalent Cation:Proton Antiporter-2 (CPA2) Family | |||||
| SPAC105.01C |
potassium ion/proton antiporter | ||||
| The Divalent Anion:Na+ Symporter (DASS) Family | |||||
| SPBC3B8.04C |
? | ||||
| The Drug/Metabolite Transporter (DMT) Superfamily | |||||
| SPCC1795.03(gms1) |
UDP-galactose or UDP-N-acetylglucosamine | ||||
| SPAC12G12.12 |
? | ||||
| SPBC1734.09 |
UDP-N-acetylglucosamine | ||||
| SPBC839.11C |
transporter? | ||||
| SPAC22E12.01(SPAC890.09) |
triose phosphate? | ||||
| The Glycoside-Pentoside-Hexuronide (GPH):Cation Symporter Family | |||||
| SPAC2F3.08 |
sucrose | ||||
| The Mitochondrial Carrier (MC) Family | |||||
| SPAC4G8.08 |
? | ||||
| SPAC4G9.20C |
? | ||||
| SPAC12B10.09 |
? | ||||
| SPAC17H9.08 |
? | ||||
| SPBC29A3.11C |
? | ||||
| SPCC1442.03(SPCC1450.19) |
? | ||||
| SPBC1604.04 |
? | ||||
| SPAC8C9.12C |
? | ||||
| SPCC1682.09C |
? | ||||
| SPBC12D12.05C |
? | ||||
| SPBC1703.13C |
phosphate | ||||
| SPAC19G12.05 |
tricarboxylate | ||||
| SPBC530.10C(anc1) |
ATP/ADP exchanger | ||||
| SPBP23A10.06 |
? | ||||
| SPBC83.13 |
? | ||||
| SPBC27B12.09C |
FAD | ||||
| SPBC1271.11 |
tricarboxylate | ||||
| SPAC227.03C |
? | ||||
| SPAC139.02C |
oxaloacetate | ||||
| SPAC328.09 |
calcium ion | ||||
| SPAC688.09 |
? | ||||
| SPAC823.10c |
? | ||||
| The Major Facilitator Superfamily (MFS) | |||||
| SPCC548.07C(ght1) |
glucose | ||||
| SPAC1F8.01(ght3) |
glucose | ||||
| SPAC20G8.03(itr2) |
myo-inositol | ||||
| SPAC23D3.12 |
inorganic phosphate | ||||
| SPAC3H1.06C |
drug efflux | ||||
| SPAC11D3.05 |
drug efflux | ||||
| SPAC11D3.18C |
tartrate? | ||||
| SPBC12C2.13C(SPBC21D10.04c) |
multidrug efflux | ||||
| SPAC17C9.16C |
multidrug efflux | ||||
| SPAC1F8.03C |
efflux | ||||
| SPAC1B3.15C |
? | ||||
| SPAC1B3.16C |
? | ||||
| SPBC530.02 |
drug efflux | ||||
| SPBC4B4.08(ght2) |
glucose | ||||
| SPBC1683.08(ght4) |
glucose | ||||
| SPCC1235.13(ght6) |
glucose | ||||
| SPCC1235.14(ght5) |
glucose | ||||
| SPCC330.07C |
? | ||||
| SPBC4F6.09 |
efflux | ||||
| SPCC18.02 |
amine | ||||
| SPCC576.17C |
drug efflux | ||||
| SPCC613.01(SPCC757.14) |
? | ||||
| SPCC613.02 |
? | ||||
| SPCC757.13 |
allantoate? | ||||
| SPBC16A3.17C |
efflux | ||||
| SPBC1773.15 |
allantoate? | ||||
| SPCC417.10 |
allantoate? | ||||
| SPBC36.01C |
drug efflux | ||||
| SPBC36.02C |
drug efflux | ||||
| SPBC36.03C |
drug efflux | ||||
| SPCC965.13 |
amiloride efflux | ||||
| SPCC794.04C |
drug efflux | ||||
| SPCC2H8.02 |
inorganic phosphate | ||||
| SPBC1683.01 |
inorganic phosphate | ||||
| SPBC1271.09 |
? | ||||
| SPCC569.05C |
drug efflux | ||||
| SPBC1683.12 |
allantoate? | ||||
| SPCC61.01C(SPCC622.20c) |
? | ||||
| SPCC1529.01(SPCC794.14) |
multidrug efflux | ||||
| SPBC947.06C |
multidrug efflux | ||||
| SPBC530.15c(SPBC661.01) |
efflux | ||||
| SPBC609.04 |
? | ||||
| SPBC3E7.06C |
? | ||||
| SPBC1683.03C |
? | ||||
| SPBC1271.10C |
multidrug efflux | ||||
| SPAC2G11.13 |
? | ||||
| SPAC14C4.07 |
? | ||||
| SPAC1039.04 |
? | ||||
| SPAC1002.16C |
? | ||||
| SPBC2G2.01c(SPBC4B4.13c) |
? | ||||
| SPAC1348.14c |
GLUCOSE PROTEIN (PARTIAL) | ||||
| SPAC1348.05 |
efflux | ||||
| SPAC1399.02 |
DRUG | ||||
| SPAC750.02c |
DRUG | ||||
| SPAPB1A11.01(SPAPB24D3.11) |
multidrug efflux (fragment) | ||||
| SPBPB2B2.16c |
DRUG | ||||
| SPCC548.06c |
glucose | ||||
| SPAPB1E7.08c
|
? | ||||
| The Multidrug/Oligosaccharidyl-lipid/Polysaccharide (MOP) Flippase Superfamily | |||||
| SPAC11D3.06 | family | ||||
| SPAC323.07c | family | ||||
| SPCC4B3.13 | family | ||||
| The Mitochondrial Tricarboxylate Carrier (MTC) Family | |||||
| SPAC17G6.15C |
tricarboxylate | ||||
| The Nucleobase:Cation Symporter-1 (NCS1) Family | |||||
| SPAC1399.03(fur4) |
uracil | ||||
| SPAC29B12.14C |
uracil | ||||
| SPBC1683.05 |
allantoate | ||||
| The Nucleobase:Cation Symporter-2 (NCS2) Family | |||||
| SPAC1399.01c |
purine | ||||
| The Ni2+-Co2+ Transporter (NiCoT) Family | |||||
| SPCC1884.02(SPCC757.01) |
heavy metal ion (lacks N-terminal 80 residues) | ||||
| The Metal Ion (Mn2+-iron) Transporter (Nramp) Family | |||||
| SPAC27F1.08 |
manganese | ||||
| The Oligopeptide Transporter (OPT) Family | |||||
| SPCC965.02(SPCC1840.12) |
oligopeptide | ||||
| SPAC29B12.10c |
oligopeptide | ||||
| SPBC29B5.02c(isp4) |
oligopeptide | ||||
| The Proton-dependent Oligopeptide Transporter (POT) Family | |||||
| SPBC13A2.04c(ptr2) |
peptide | ||||
| The Solute:Sodium Symporter (SSS) Family | |||||
| SPBC23G7.13C |
urea | ||||
| SPAC869.03C |
urea | ||||
| The Sulfate Permease (SulP) Family | |||||
| SPAC24H6.11C |
sulfate | ||||
| SPCC320.05 |
sulfate | ||||
| SPBC3H7.02 |
sulfate | ||||
| SPAC869.05C |
sulfate | ||||
| The Telurite-resistance/Dicarboxylate Transporter (TDT) Family | |||||
| SPAPB8E5.03(mae1) |
malic acid | ||||
| SPCC794.06 |
malic acid | ||||
| The K+ Transporter (Trk) Family | |||||
| SPAC1F5.12(SPAC1639.02c) |
potassium | ||||
| SPAC3F10.02C(trk1) |
potassium | ||||
| The Zinc (Zn2+)-Iron (Fe2+) Permease (ZIP) Family | |||||
| SPBC16D10.06 |
zinc | ||||
Unclassified |
| The Low Affinity Fe2+ Transporter (FeT) Family | |||||
| SPBP26C9.03c |
iron | ||||